C21H31F5O3 — CID 56624124
5-octyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56624124) has the molecular formula C21H31F5O3 and a molecular weight of 426.47 g/mol. Its IUPAC name is 5-octyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-octyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56624124 |
| Molecular Formula | C21H31F5O3 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 5-octyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCCCCCC1COC(C2=CCC(OC(F)(F)C(F)(F)CF)C=C2)OC1 |
| InChI | InChI=1S/C21H31F5O3/c1-2-3-4-5-6-7-8-16-13-27-19(28-14-16)17-9-11-18(12-10-17)29-21(25,26)20(23,24)15-22/h9-11,16,18-19H,2-8,12-15H2,1H3 |
| InChIKey | UYJCTVQZHGJOHP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|