About N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine
N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine (PubChem CID 56624164) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine.
Molecular Properties
| Compound Name | N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine |
| PubChem CID | 56624164 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine |
| SMILES | C1=CCC(N=C2CC=CC2)=C1 |
| InChI | InChI=1S/C10H11N/c1-2-6-9(5-1)11-10-7-3-4-8-10/h1-5H,6-8H2 |
| InChIKey | TWIAGWDAYVEJNJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine?
The IUPAC name of N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine (CID 56624164) is N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine.
What is the SMILES notation for N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine?
The canonical SMILES for N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine is C1=CCC(N=C2CC=CC2)=C1.
What is the InChIKey of N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine?
The InChIKey is TWIAGWDAYVEJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-2-6-9(5-1)11-10-7-3-4-8-10/h1-5H,6-8H2.
What are the key properties of N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine?
N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine has a molecular weight of 145.20 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopenta-1,3-dien-1-ylcyclopent-3-en-1-imine is sourced from PubChem (CID 56624164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).