C19H23F7O — CID 56624214
5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-propylcyclohexen-1-yl)cyclohexa-1,3-diene (PubChem CID 56624214) has the molecular formula C19H23F7O and a molecular weight of 400.38 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-propylcyclohexen-1-yl)cyclohexa-1,3-diene.
| Compound Name | 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-propylcyclohexen-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56624214 |
| Molecular Formula | C19H23F7O |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-propylcyclohexen-1-yl)cyclohexa-1,3-diene |
| SMILES | CCCC1CC=C(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)CC1 |
| InChI | InChI=1S/C19H23F7O/c1-2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)27-19(25,26)18(23,24)17(21,22)12-20/h6,8-10,13,16H,2-5,7,11-12H2,1H3 |
| InChIKey | ARVMNVREZHKESV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|