About 6-methyl-2-propan-2-yl-1,8-naphthyridine
6-methyl-2-propan-2-yl-1,8-naphthyridine (PubChem CID 56624410) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 6-methyl-2-propan-2-yl-1,8-naphthyridine.
Molecular Properties
| Compound Name | 6-methyl-2-propan-2-yl-1,8-naphthyridine |
| PubChem CID | 56624410 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 6-methyl-2-propan-2-yl-1,8-naphthyridine |
| SMILES | Cc1cnc2nc(C(C)C)ccc2c1 |
| InChI | InChI=1S/C12H14N2/c1-8(2)11-5-4-10-6-9(3)7-13-12(10)14-11/h4-8H,1-3H3 |
| InChIKey | APJVKVXBCREFOV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2-propan-2-yl-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-propan-2-yl-1,8-naphthyridine?
The IUPAC name of 6-methyl-2-propan-2-yl-1,8-naphthyridine (CID 56624410) is 6-methyl-2-propan-2-yl-1,8-naphthyridine.
What is the SMILES notation for 6-methyl-2-propan-2-yl-1,8-naphthyridine?
The canonical SMILES for 6-methyl-2-propan-2-yl-1,8-naphthyridine is Cc1cnc2nc(C(C)C)ccc2c1.
What is the InChIKey of 6-methyl-2-propan-2-yl-1,8-naphthyridine?
The InChIKey is APJVKVXBCREFOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-8(2)11-5-4-10-6-9(3)7-13-12(10)14-11/h4-8H,1-3H3.
What are the key properties of 6-methyl-2-propan-2-yl-1,8-naphthyridine?
6-methyl-2-propan-2-yl-1,8-naphthyridine has a molecular weight of 186.26 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-propan-2-yl-1,8-naphthyridine is sourced from PubChem (CID 56624410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).