C11H19N6O3P — CID 56624952
3-[[di(propan-2-yl)amino]-(5-nitro-1H-1,2,4-triazol-3-yl)phosphanyl]oxypropanenitrile (PubChem CID 56624952) has the molecular formula C11H19N6O3P and a molecular weight of 314.29 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-(5-nitro-1H-1,2,4-triazol-3-yl)phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-(5-nitro-1H-1,2,4-triazol-3-yl)phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 56624952 |
| Molecular Formula | C11H19N6O3P |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-(5-nitro-1H-1,2,4-triazol-3-yl)phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)c1n[nH]c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H19N6O3P/c1-8(2)16(9(3)4)21(20-7-5-6-12)11-13-10(14-15-11)17(18)19/h8-9H,5,7H2,1-4H3,(H,13,14,15) |
| InChIKey | INBIURGYGGCCEG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|