About 2-hydroxymorpholin-3-one
2-hydroxymorpholin-3-one (PubChem CID 56625144) has the molecular formula C4H7NO3
and a molecular weight of 117.10 g/mol. Its IUPAC name is 2-hydroxymorpholin-3-one.
Molecular Properties
| Compound Name | 2-hydroxymorpholin-3-one |
| PubChem CID | 56625144 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 2-hydroxymorpholin-3-one |
| SMILES | O=C1NCCOC1O |
| InChI | InChI=1S/C4H7NO3/c6-3-4(7)8-2-1-5-3/h4,7H,1-2H2,(H,5,6) |
| InChIKey | UETQBZQCEYKFIH-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxymorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxymorpholin-3-one?
The IUPAC name of 2-hydroxymorpholin-3-one (CID 56625144) is 2-hydroxymorpholin-3-one.
What is the SMILES notation for 2-hydroxymorpholin-3-one?
The canonical SMILES for 2-hydroxymorpholin-3-one is O=C1NCCOC1O.
What is the InChIKey of 2-hydroxymorpholin-3-one?
The InChIKey is UETQBZQCEYKFIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3/c6-3-4(7)8-2-1-5-3/h4,7H,1-2H2,(H,5,6).
What are the key properties of 2-hydroxymorpholin-3-one?
2-hydroxymorpholin-3-one has a molecular weight of 117.10 g/mol, XLogP of -1.55, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxymorpholin-3-one is sourced from PubChem (CID 56625144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).