About N,1-dimethyl-2,3-dihydropyridin-4-imine
N,1-dimethyl-2,3-dihydropyridin-4-imine (PubChem CID 56625157) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N,1-dimethyl-2,3-dihydropyridin-4-imine.
Molecular Properties
| Compound Name | N,1-dimethyl-2,3-dihydropyridin-4-imine |
| PubChem CID | 56625157 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N,1-dimethyl-2,3-dihydropyridin-4-imine |
| SMILES | C/N=C1\C=CN(C)CC1 |
| InChI | InChI=1S/C7H12N2/c1-8-7-3-5-9(2)6-4-7/h3,5H,4,6H2,1-2H3/b8-7+ |
| InChIKey | DDJFOPZBZIPDLU-BQYQJAHWSA-N |
| XLogP | 0.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,1-dimethyl-2,3-dihydropyridin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dimethyl-2,3-dihydropyridin-4-imine?
The IUPAC name of N,1-dimethyl-2,3-dihydropyridin-4-imine (CID 56625157) is N,1-dimethyl-2,3-dihydropyridin-4-imine.
What is the SMILES notation for N,1-dimethyl-2,3-dihydropyridin-4-imine?
The canonical SMILES for N,1-dimethyl-2,3-dihydropyridin-4-imine is C/N=C1\C=CN(C)CC1.
What is the InChIKey of N,1-dimethyl-2,3-dihydropyridin-4-imine?
The InChIKey is DDJFOPZBZIPDLU-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H12N2/c1-8-7-3-5-9(2)6-4-7/h3,5H,4,6H2,1-2H3/b8-7+.
What are the key properties of N,1-dimethyl-2,3-dihydropyridin-4-imine?
N,1-dimethyl-2,3-dihydropyridin-4-imine has a molecular weight of 124.19 g/mol, XLogP of 0.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dimethyl-2,3-dihydropyridin-4-imine is sourced from PubChem (CID 56625157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).