C19H25F5O — CID 56625178
2-(4-butylcyclohexen-1-yl)-5-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,3-diene (PubChem CID 56625178) has the molecular formula C19H25F5O and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-(4-butylcyclohexen-1-yl)-5-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,3-diene.
| Compound Name | 2-(4-butylcyclohexen-1-yl)-5-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56625178 |
| Molecular Formula | C19H25F5O |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-(4-butylcyclohexen-1-yl)-5-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,3-diene |
| SMILES | CCCCC1CC=C(C2=CCC(OC(F)(F)C(F)(F)CF)C=C2)CC1 |
| InChI | InChI=1S/C19H25F5O/c1-2-3-4-14-5-7-15(8-6-14)16-9-11-17(12-10-16)25-19(23,24)18(21,22)13-20/h7,9-11,14,17H,2-6,8,12-13H2,1H3 |
| InChIKey | KFKWBLIDZGYFOR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|