C21H37FO4 — CID 56625348
7-[(1R,2S,3R,5S)-2-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid (PubChem CID 56625348) has the molecular formula C21H37FO4 and a molecular weight of 372.52 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5S)-2-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3R,5S)-2-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 56625348 |
| Molecular Formula | C21H37FO4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 7-[(1R,2S,3R,5S)-2-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-5-hydroxy-3-methylcyclopentyl]hept-5-enoic acid |
| SMILES | CCCC[C@@H](F)[C@H](O)CC[C@@H]1[C@@H](CC=CCCCC(=O)O)[C@@H](O)C[C@H]1C |
| InChI | InChI=1S/C21H37FO4/c1-3-4-10-18(22)19(23)13-12-16-15(2)14-20(24)17(16)9-7-5-6-8-11-21(25)26/h5,7,15-20,23-24H,3-4,6,8-14H2,1-2H3,(H,25,26)/t15-,16+,17-,18-,19-,20+/m1/s1 |
| InChIKey | YMKVEKCWVOHEIM-BGSOWLKRSA-N |
| XLogP | 4.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|