C14H16N2 — CID 56625543
(6aR)-4,5,5a,6,6a,9,10,10a-octahydroindolo[4,3-fg]quinoline (PubChem CID 56625543) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (6aR)-4,5,5a,6,6a,9,10,10a-octahydroindolo[4,3-fg]quinoline.
| Compound Name | (6aR)-4,5,5a,6,6a,9,10,10a-octahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 56625543 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (6aR)-4,5,5a,6,6a,9,10,10a-octahydroindolo[4,3-fg]quinoline |
| SMILES | C1=N[C@@H]2CC3CNc4cccc(c43)C2CC1 |
| InChI | InChI=1S/C14H16N2/c1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11/h1,3,5-6,9-10,13,16H,2,4,7-8H2/t9?,10?,13-/m1/s1 |
| InChIKey | VFAXXZZUZNUMAQ-SRHKJQAYSA-N |
| XLogP | 2.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |