C25H17Cl2NO8 — CID 56625646
4-(4,5-dichloro-3-hydroxy-2,7-dimethyl-6-oxoxanthen-9-yl)-6-(formamidomethylidene)cyclohexa-1,3-diene-1,3-dicarboxylic acid (PubChem CID 56625646) has the molecular formula C25H17Cl2NO8 and a molecular weight of 530.32 g/mol. Its IUPAC name is 4-(4,5-dichloro-3-hydroxy-2,7-dimethyl-6-oxoxanthen-9-yl)-6-(formamidomethylidene)cyclohexa-1,3-diene-1,3-dicarboxylic acid.
| Compound Name | 4-(4,5-dichloro-3-hydroxy-2,7-dimethyl-6-oxoxanthen-9-yl)-6-(formamidomethylidene)cyclohexa-1,3-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 56625646 |
| Molecular Formula | C25H17Cl2NO8 |
| Molecular Weight | 530.32 g/mol |
| Exact Mass | 529.03 |
| IUPAC Name | 4-(4,5-dichloro-3-hydroxy-2,7-dimethyl-6-oxoxanthen-9-yl)-6-(formamidomethylidene)cyclohexa-1,3-diene-1,3-dicarboxylic acid |
| SMILES | Cc1cc2c(C3=C(C(=O)O)C=C(C(=O)O)C(=CNC=O)C3)c3cc(C)c(=O)c(Cl)c-3oc2c(Cl)c1O |
| InChI | InChI=1S/C25H17Cl2NO8/c1-9-3-15-17(13-5-11(7-28-8-29)12(24(32)33)6-14(13)25(34)35)16-4-10(2)21(31)19(27)23(16)36-22(15)18(26)20(9)30/h3-4,6-8,30H,5H2,1-2H3,(H,28,29)(H,32,33)(H,34,35) |
| InChIKey | TZFIVIKHPNFJLP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|