C23H28O4 — CID 56625680
(2R,3S,3aS,9bR)-2-ethyl-9-methoxy-5-methyl-3-[(2-methylphenyl)methoxy]-3,3a,5,9b-tetrahydro-2H-furo[3,2-c]isochromene (PubChem CID 56625680) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (2R,3S,3aS,9bR)-2-ethyl-9-methoxy-5-methyl-3-[(2-methylphenyl)methoxy]-3,3a,5,9b-tetrahydro-2H-furo[3,2-c]isochromene.
| Compound Name | (2R,3S,3aS,9bR)-2-ethyl-9-methoxy-5-methyl-3-[(2-methylphenyl)methoxy]-3,3a,5,9b-tetrahydro-2H-furo[3,2-c]isochromene |
|---|---|
| PubChem CID | 56625680 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (2R,3S,3aS,9bR)-2-ethyl-9-methoxy-5-methyl-3-[(2-methylphenyl)methoxy]-3,3a,5,9b-tetrahydro-2H-furo[3,2-c]isochromene |
| SMILES | CC[C@H]1O[C@@H]2c3c(OC)cccc3C(C)O[C@@H]2[C@H]1OCc1ccccc1C |
| InChI | InChI=1S/C23H28O4/c1-5-18-21(25-13-16-10-7-6-9-14(16)2)23-22(27-18)20-17(15(3)26-23)11-8-12-19(20)24-4/h6-12,15,18,21-23H,5,13H2,1-4H3/t15?,18-,21+,22-,23-/m1/s1 |
| InChIKey | ZWOPJHRNWXWVTA-QPEGORDRSA-N |
| XLogP | 4.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |