C8H4F10O — CID 56625874
3,3,4,4,4-pentafluoro-2-(3,3,4,4,4-pentafluorobut-1-en-2-yloxy)but-1-ene (PubChem CID 56625874) has the molecular formula C8H4F10O and a molecular weight of 306.10 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluoro-2-(3,3,4,4,4-pentafluorobut-1-en-2-yloxy)but-1-ene.
| Compound Name | 3,3,4,4,4-pentafluoro-2-(3,3,4,4,4-pentafluorobut-1-en-2-yloxy)but-1-ene |
|---|---|
| PubChem CID | 56625874 |
| Molecular Formula | C8H4F10O |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 3,3,4,4,4-pentafluoro-2-(3,3,4,4,4-pentafluorobut-1-en-2-yloxy)but-1-ene |
| SMILES | C=C(OC(=C)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F10O/c1-3(5(9,10)7(13,14)15)19-4(2)6(11,12)8(16,17)18/h1-2H2 |
| InChIKey | HFJBBSHXNKCYPL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|