C23H30O5 — CID 56625887
(8R,9S,10R,13R,14S,17S)-17-(2-hydroxyacetyl)-13-(1-hydroxy-3-oxoprop-2-enyl)-10-methyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 56625887) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S,17S)-17-(2-hydroxyacetyl)-13-(1-hydroxy-3-oxoprop-2-enyl)-10-methyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13R,14S,17S)-17-(2-hydroxyacetyl)-13-(1-hydroxy-3-oxoprop-2-enyl)-10-methyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56625887 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (8R,9S,10R,13R,14S,17S)-17-(2-hydroxyacetyl)-13-(1-hydroxy-3-oxoprop-2-enyl)-10-methyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@H](C(=O)CO)[C@@]3(C(O)C=C=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H30O5/c1-22-9-6-15(26)12-14(22)2-3-16-17(22)7-10-23(21(28)8-11-24)18(16)4-5-19(23)20(27)13-25/h8,12,16-19,21,25,28H,2-7,9-10,13H2,1H3/t16-,17+,18+,19-,21?,22+,23-/m1/s1 |
| InChIKey | DFCLOMJDFARUBH-FKULJHAJSA-N |
| XLogP | 2.42 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|