About 2-cyclopropyl-6-methyl-1,8-naphthyridine
2-cyclopropyl-6-methyl-1,8-naphthyridine (PubChem CID 56626435) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-cyclopropyl-6-methyl-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-cyclopropyl-6-methyl-1,8-naphthyridine |
| PubChem CID | 56626435 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-cyclopropyl-6-methyl-1,8-naphthyridine |
| SMILES | Cc1cnc2nc(C3CC3)ccc2c1 |
| InChI | InChI=1S/C12H12N2/c1-8-6-10-4-5-11(9-2-3-9)14-12(10)13-7-8/h4-7,9H,2-3H2,1H3 |
| InChIKey | RARAGMRFYBGUFH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-6-methyl-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-6-methyl-1,8-naphthyridine?
The IUPAC name of 2-cyclopropyl-6-methyl-1,8-naphthyridine (CID 56626435) is 2-cyclopropyl-6-methyl-1,8-naphthyridine.
What is the SMILES notation for 2-cyclopropyl-6-methyl-1,8-naphthyridine?
The canonical SMILES for 2-cyclopropyl-6-methyl-1,8-naphthyridine is Cc1cnc2nc(C3CC3)ccc2c1.
What is the InChIKey of 2-cyclopropyl-6-methyl-1,8-naphthyridine?
The InChIKey is RARAGMRFYBGUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2/c1-8-6-10-4-5-11(9-2-3-9)14-12(10)13-7-8/h4-7,9H,2-3H2,1H3.
What are the key properties of 2-cyclopropyl-6-methyl-1,8-naphthyridine?
2-cyclopropyl-6-methyl-1,8-naphthyridine has a molecular weight of 184.24 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-6-methyl-1,8-naphthyridine is sourced from PubChem (CID 56626435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).