About (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid
(6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid (PubChem CID 56626538) has the molecular formula C7H9BO2
and a molecular weight of 135.96 g/mol. Its IUPAC name is (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid.
Molecular Properties
| Compound Name | (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid |
| PubChem CID | 56626538 |
| Molecular Formula | C7H9BO2 |
| Molecular Weight | 135.96 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid |
| SMILES | C=C1CC=CC=C1B(O)O |
| InChI | InChI=1S/C7H9BO2/c1-6-4-2-3-5-7(6)8(9)10/h2-3,5,9-10H,1,4H2 |
| InChIKey | WULMLSMFELMHKE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.96 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid?
The IUPAC name of (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid (CID 56626538) is (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid.
What is the SMILES notation for (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid?
The canonical SMILES for (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid is C=C1CC=CC=C1B(O)O.
What is the InChIKey of (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid?
The InChIKey is WULMLSMFELMHKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BO2/c1-6-4-2-3-5-7(6)8(9)10/h2-3,5,9-10H,1,4H2.
What are the key properties of (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid?
(6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid has a molecular weight of 135.96 g/mol, XLogP of 0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylidenecyclohexa-1,3-dien-1-yl)boronic acid is sourced from PubChem (CID 56626538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).