About 5,7-dihydrothiopyrano[3,2-c]pyran
5,7-dihydrothiopyrano[3,2-c]pyran (PubChem CID 56626595) has the molecular formula C8H8OS
and a molecular weight of 152.22 g/mol. Its IUPAC name is 5,7-dihydrothiopyrano[3,2-c]pyran.
Molecular Properties
| Compound Name | 5,7-dihydrothiopyrano[3,2-c]pyran |
| PubChem CID | 56626595 |
| Molecular Formula | C8H8OS |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 5,7-dihydrothiopyrano[3,2-c]pyran |
| SMILES | C1=CSC2=CCOCC2=C1 |
| InChI | InChI=1S/C8H8OS/c1-2-7-6-9-4-3-8(7)10-5-1/h1-3,5H,4,6H2 |
| InChIKey | OVWKQHFUVBAJJR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dihydrothiopyrano[3,2-c]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydrothiopyrano[3,2-c]pyran?
The IUPAC name of 5,7-dihydrothiopyrano[3,2-c]pyran (CID 56626595) is 5,7-dihydrothiopyrano[3,2-c]pyran.
What is the SMILES notation for 5,7-dihydrothiopyrano[3,2-c]pyran?
The canonical SMILES for 5,7-dihydrothiopyrano[3,2-c]pyran is C1=CSC2=CCOCC2=C1.
What is the InChIKey of 5,7-dihydrothiopyrano[3,2-c]pyran?
The InChIKey is OVWKQHFUVBAJJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8OS/c1-2-7-6-9-4-3-8(7)10-5-1/h1-3,5H,4,6H2.
What are the key properties of 5,7-dihydrothiopyrano[3,2-c]pyran?
5,7-dihydrothiopyrano[3,2-c]pyran has a molecular weight of 152.22 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydrothiopyrano[3,2-c]pyran is sourced from PubChem (CID 56626595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).