C43H49NO9 — CID 56626734
benzhydryl 2-[[8-(3-cyanopropoxy)-9-hydroxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylate (PubChem CID 56626734) has the molecular formula C43H49NO9 and a molecular weight of 723.86 g/mol. Its IUPAC name is benzhydryl 2-[[8-(3-cyanopropoxy)-9-hydroxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylate.
| Compound Name | benzhydryl 2-[[8-(3-cyanopropoxy)-9-hydroxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylate |
|---|---|
| PubChem CID | 56626734 |
| Molecular Formula | C43H49NO9 |
| Molecular Weight | 723.86 g/mol |
| Exact Mass | 723.34 |
| IUPAC Name | benzhydryl 2-[[8-(3-cyanopropoxy)-9-hydroxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylate |
| SMILES | CC(C)C1=CC2CC3(C=O)C4CCC(C)C4CC2(COC24OC5OC(C(OCCCC#N)C5O2)C4O)C13C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H49NO9/c1-25(2)32-20-29-21-40(23-45)31-17-16-26(3)30(31)22-41(29,24-49-43-37(46)35-34(48-19-11-10-18-44)36(52-43)38(50-35)53-43)42(32,40)39(47)51-33(27-12-6-4-7-13-27)28-14-8-5-9-15-28/h4-9,12-15,20,23,25-26,29-31,33-38,46H,10-11,16-17,19,21-22,24H2,1-3H3 |
| InChIKey | BKHYZUWNEUKVBW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.86 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|