About S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate
S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate (PubChem CID 56627222) has the molecular formula C10H17Cl2NOS
and a molecular weight of 270.23 g/mol. Its IUPAC name is S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate.
Molecular Properties
| Compound Name | S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate |
| PubChem CID | 56627222 |
| Molecular Formula | C10H17Cl2NOS |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate |
| SMILES | CC(Cl)=C(Cl)SC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C10H17Cl2NOS/c1-6(2)13(7(3)4)10(14)15-9(12)8(5)11/h6-7H,1-5H3 |
| InChIKey | LBFOEEAEYPCUQQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate?
The IUPAC name of S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate (CID 56627222) is S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate.
What is the SMILES notation for S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate?
The canonical SMILES for S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate is CC(Cl)=C(Cl)SC(=O)N(C(C)C)C(C)C.
What is the InChIKey of S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate?
The InChIKey is LBFOEEAEYPCUQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Cl2NOS/c1-6(2)13(7(3)4)10(14)15-9(12)8(5)11/h6-7H,1-5H3.
What are the key properties of S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate?
S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate has a molecular weight of 270.23 g/mol, XLogP of 4.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1,2-dichloroprop-1-enyl) N,N-di(propan-2-yl)carbamothioate is sourced from PubChem (CID 56627222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).