C16H15NO4 — CID 56627338
[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino] benzoate (PubChem CID 56627338) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is [(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino] benzoate.
| Compound Name | [(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino] benzoate |
|---|---|
| PubChem CID | 56627338 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino] benzoate |
| SMILES | O=C(ON=C1C(=O)C2CCCCC2C1=O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO4/c18-14-11-8-4-5-9-12(11)15(19)13(14)17-21-16(20)10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9H2 |
| InChIKey | VMPRRPOPWQFNFF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|