C21H27F7O — CID 56627804
5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-pentylcyclohexen-1-yl)cyclohexa-1,3-diene (PubChem CID 56627804) has the molecular formula C21H27F7O and a molecular weight of 428.43 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-pentylcyclohexen-1-yl)cyclohexa-1,3-diene.
| Compound Name | 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-pentylcyclohexen-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56627804 |
| Molecular Formula | C21H27F7O |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-pentylcyclohexen-1-yl)cyclohexa-1,3-diene |
| SMILES | CCCCCC1CC=C(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)CC1 |
| InChI | InChI=1S/C21H27F7O/c1-2-3-4-5-15-6-8-16(9-7-15)17-10-12-18(13-11-17)29-21(27,28)20(25,26)19(23,24)14-22/h8,10-12,15,18H,2-7,9,13-14H2,1H3 |
| InChIKey | BFIOTWHYRGLJCC-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|