C32H44O6S — CID 56628222
[(1S,3R,8S,9S,10R,13S,14S,17R)-1-acetyloxy-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 56628222) has the molecular formula C32H44O6S and a molecular weight of 556.77 g/mol. Its IUPAC name is [(1S,3R,8S,9S,10R,13S,14S,17R)-1-acetyloxy-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(1S,3R,8S,9S,10R,13S,14S,17R)-1-acetyloxy-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 56628222 |
| Molecular Formula | C32H44O6S |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | [(1S,3R,8S,9S,10R,13S,14S,17R)-1-acetyloxy-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CS(=O)(=O)c5ccccc5)[C@@]4(C)CC[C@@H]3[C@@]2(C)[C@@H](OC(C)=O)C1 |
| InChI | InChI=1S/C32H44O6S/c1-20(19-39(35,36)25-9-7-6-8-10-25)27-13-14-28-26-12-11-23-17-24(37-21(2)33)18-30(38-22(3)34)32(23,5)29(26)15-16-31(27,28)4/h6-11,20,24,26-30H,12-19H2,1-5H3/t20-,24-,26+,27-,28+,29+,30+,31-,32+/m1/s1 |
| InChIKey | CZOWFUUUPODYHV-QCPZYAIYSA-N |
| XLogP | 6.15 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|