C9H18O6Si — CID 56628274
(3R,4S,5R,6R)-4,5,6-trihydroxy-3-trimethylsilyloxyoxepan-2-one (PubChem CID 56628274) has the molecular formula C9H18O6Si and a molecular weight of 250.32 g/mol. Its IUPAC name is (3R,4S,5R,6R)-4,5,6-trihydroxy-3-trimethylsilyloxyoxepan-2-one.
| Compound Name | (3R,4S,5R,6R)-4,5,6-trihydroxy-3-trimethylsilyloxyoxepan-2-one |
|---|---|
| PubChem CID | 56628274 |
| Molecular Formula | C9H18O6Si |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (3R,4S,5R,6R)-4,5,6-trihydroxy-3-trimethylsilyloxyoxepan-2-one |
| SMILES | C[Si](C)(C)O[C@H]1C(=O)OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H18O6Si/c1-16(2,3)15-8-7(12)6(11)5(10)4-14-9(8)13/h5-8,10-12H,4H2,1-3H3/t5-,6-,7+,8-/m1/s1 |
| InChIKey | UGTGQTLWCQVJAO-OOJXKGFFSA-N |
| XLogP | -1.15 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|