C5H6N4O — CID 56628303
3,7,8,9-tetrahydropurin-2-one (PubChem CID 56628303) has the molecular formula C5H6N4O and a molecular weight of 138.13 g/mol. Its IUPAC name is 3,7,8,9-tetrahydropurin-2-one.
| Compound Name | 3,7,8,9-tetrahydropurin-2-one |
|---|---|
| PubChem CID | 56628303 |
| Molecular Formula | C5H6N4O |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 3,7,8,9-tetrahydropurin-2-one |
| SMILES | O=c1ncc2c([nH]1)NCN2 |
| InChI | InChI=1S/C5H6N4O/c10-5-6-1-3-4(9-5)8-2-7-3/h1,7H,2H2,(H2,6,8,9,10) |
| InChIKey | KBTIKGLWVWLUFI-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |