C21H32F2O2 — CID 56628309
1-(2,2-difluoroethyl)-4-(4-hexylcyclohexa-2,4-dien-1-yl)cyclohexane-1-carboxylic acid (PubChem CID 56628309) has the molecular formula C21H32F2O2 and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-(4-hexylcyclohexa-2,4-dien-1-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(2,2-difluoroethyl)-4-(4-hexylcyclohexa-2,4-dien-1-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 56628309 |
| Molecular Formula | C21H32F2O2 |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-(4-hexylcyclohexa-2,4-dien-1-yl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCC1=CCC(C2CCC(CC(F)F)(C(=O)O)CC2)C=C1 |
| InChI | InChI=1S/C21H32F2O2/c1-2-3-4-5-6-16-7-9-17(10-8-16)18-11-13-21(14-12-18,20(24)25)15-19(22)23/h7-9,17-19H,2-6,10-15H2,1H3,(H,24,25) |
| InChIKey | XNBZGAXUFIUOEJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|