About 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione
3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione (PubChem CID 56628474) has the molecular formula C14H18O5
and a molecular weight of 266.29 g/mol. Its IUPAC name is 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione.
Molecular Properties
| Compound Name | 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione |
| PubChem CID | 56628474 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione |
| SMILES | O=C1CCCC(C2CCCC3(OCCO3)C2=O)C1=O |
| InChI | InChI=1S/C14H18O5/c15-11-5-1-3-9(12(11)16)10-4-2-6-14(13(10)17)18-7-8-19-14/h9-10H,1-8H2 |
| InChIKey | GRBVMVVGDPMSAO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione?
The IUPAC name of 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione (CID 56628474) is 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione.
What is the SMILES notation for 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione?
The canonical SMILES for 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione is O=C1CCCC(C2CCCC3(OCCO3)C2=O)C1=O.
What is the InChIKey of 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione?
The InChIKey is GRBVMVVGDPMSAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5/c15-11-5-1-3-9(12(11)16)10-4-2-6-14(13(10)17)18-7-8-19-14/h9-10H,1-8H2.
What are the key properties of 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione?
3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione has a molecular weight of 266.29 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-oxo-1,4-dioxaspiro[4.5]decan-7-yl)cyclohexane-1,2-dione is sourced from PubChem (CID 56628474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).