About 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide
3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide (PubChem CID 56628519) has the molecular formula C25H26N2O2S
and a molecular weight of 418.56 g/mol. Its IUPAC name is 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide.
Molecular Properties
| Compound Name | 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide |
| PubChem CID | 56628519 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide |
| SMILES | Cc1cccc(C)c1SCc1ccc(OCCc2ccccc2)c(C=CC(N)=O)n1 |
| InChI | InChI=1S/C25H26N2O2S/c1-18-7-6-8-19(2)25(18)30-17-21-11-13-23(22(27-21)12-14-24(26)28)29-16-15-20-9-4-3-5-10-20/h3-14H,15-17H2,1-2H3,(H2,26,28) |
| InChIKey | IAUYHMUTWHUEBB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide?
The IUPAC name of 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide (CID 56628519) is 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide.
What is the SMILES notation for 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide?
The canonical SMILES for 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide is Cc1cccc(C)c1SCc1ccc(OCCc2ccccc2)c(C=CC(N)=O)n1.
What is the InChIKey of 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide?
The InChIKey is IAUYHMUTWHUEBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O2S/c1-18-7-6-8-19(2)25(18)30-17-21-11-13-23(22(27-21)12-14-24(26)28)29-16-15-20-9-4-3-5-10-20/h3-14H,15-17H2,1-2H3,(H2,26,28).
What are the key properties of 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide?
3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide has a molecular weight of 418.56 g/mol, XLogP of 5.11, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[(2,6-dimethylphenyl)sulfanylmethyl]-3-(2-phenylethoxy)-2-pyridinyl]prop-2-enamide is sourced from PubChem (CID 56628519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).