C30H28N2O6 — CID 56628581
6-methyl-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 56628581) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is 6-methyl-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-methyl-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 56628581 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 6-methyl-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(OCCCCCCOc2ccc(-n3c(=O)c4cc5c(=O)n(C)c(=O)c5cc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O6/c1-19-7-11-21(12-8-19)37-15-5-3-4-6-16-38-22-13-9-20(10-14-22)32-29(35)25-17-23-24(18-26(25)30(32)36)28(34)31(2)27(23)33/h7-14,17-18H,3-6,15-16H2,1-2H3 |
| InChIKey | MULPAEINTQIMQV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|