C16H6O6 — CID 56628669
7,12-dioxatetracyclo[12.3.1.02,9.05,10]octadeca-1(18),2(9),3,5(10),14,16-hexaene-6,8,11,13-tetrone (PubChem CID 56628669) has the molecular formula C16H6O6 and a molecular weight of 294.22 g/mol. Its IUPAC name is 7,12-dioxatetracyclo[12.3.1.02,9.05,10]octadeca-1(18),2(9),3,5(10),14,16-hexaene-6,8,11,13-tetrone.
| Compound Name | 7,12-dioxatetracyclo[12.3.1.02,9.05,10]octadeca-1(18),2(9),3,5(10),14,16-hexaene-6,8,11,13-tetrone |
|---|---|
| PubChem CID | 56628669 |
| Molecular Formula | C16H6O6 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 7,12-dioxatetracyclo[12.3.1.02,9.05,10]octadeca-1(18),2(9),3,5(10),14,16-hexaene-6,8,11,13-tetrone |
| SMILES | O=C1OC(=O)c2c3ccc(c2C(=O)OC3=O)-c2cccc1c2 |
| InChI | InChI=1S/C16H6O6/c17-13-8-3-1-2-7(6-8)9-4-5-10-12(16(20)21-13)11(9)15(19)22-14(10)18/h1-6H |
| InChIKey | XQFWQMRCXUMYPH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|