C12H14O — CID 56628699
7-phenyl-2,3,4,7-tetrahydrooxepine (PubChem CID 56628699) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 7-phenyl-2,3,4,7-tetrahydrooxepine.
| Compound Name | 7-phenyl-2,3,4,7-tetrahydrooxepine |
|---|---|
| PubChem CID | 56628699 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 7-phenyl-2,3,4,7-tetrahydrooxepine |
| SMILES | C1=CC(c2ccccc2)OCCC1 |
| InChI | InChI=1S/C12H14O/c1-3-7-11(8-4-1)12-9-5-2-6-10-13-12/h1,3-5,7-9,12H,2,6,10H2 |
| InChIKey | CJFXIVOOQFXCIP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|