C6H9N5O — CID 56628873
6-(methylamino)-1,3,4,7-tetrahydropurin-2-one (PubChem CID 56628873) has the molecular formula C6H9N5O and a molecular weight of 167.17 g/mol. Its IUPAC name is 6-(methylamino)-1,3,4,7-tetrahydropurin-2-one.
| Compound Name | 6-(methylamino)-1,3,4,7-tetrahydropurin-2-one |
|---|---|
| PubChem CID | 56628873 |
| Molecular Formula | C6H9N5O |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 6-(methylamino)-1,3,4,7-tetrahydropurin-2-one |
| SMILES | CNC1=C2NC=NC2NC(=O)N1 |
| InChI | InChI=1S/C6H9N5O/c1-7-4-3-5(9-2-8-3)11-6(12)10-4/h2,5,7H,1H3,(H,8,9)(H2,10,11,12) |
| InChIKey | DSBBBXGTFHABGW-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |