C17H13ClN2O3S — CID 56628953
N-(4-chloro-7-oxocyclohepta-1,3,5-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide (PubChem CID 56628953) has the molecular formula C17H13ClN2O3S and a molecular weight of 360.82 g/mol. Its IUPAC name is N-(4-chloro-7-oxocyclohepta-1,3,5-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide.
| Compound Name | N-(4-chloro-7-oxocyclohepta-1,3,5-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 56628953 |
| Molecular Formula | C17H13ClN2O3S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | N-(4-chloro-7-oxocyclohepta-1,3,5-trien-1-yl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
| SMILES | CN1Sc2ccccc2C(=O)C1C(=O)Nc1ccc(Cl)ccc1=O |
| InChI | InChI=1S/C17H13ClN2O3S/c1-20-15(16(22)11-4-2-3-5-14(11)24-20)17(23)19-12-8-6-10(18)7-9-13(12)21/h2-9,15H,1H3,(H,19,21,23) |
| InChIKey | AYTVKWBFZUMJDY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|