About 4-amino-5-fluoro-1,3-diazinan-2-one
4-amino-5-fluoro-1,3-diazinan-2-one (PubChem CID 56629715) has the molecular formula C4H8FN3O
and a molecular weight of 133.13 g/mol. Its IUPAC name is 4-amino-5-fluoro-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 4-amino-5-fluoro-1,3-diazinan-2-one |
| PubChem CID | 56629715 |
| Molecular Formula | C4H8FN3O |
| Molecular Weight | 133.13 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 4-amino-5-fluoro-1,3-diazinan-2-one |
| SMILES | NC1NC(=O)NCC1F |
| InChI | InChI=1S/C4H8FN3O/c5-2-1-7-4(9)8-3(2)6/h2-3H,1,6H2,(H2,7,8,9) |
| InChIKey | XRITUBRVWHTBIO-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.13 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-5-fluoro-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-fluoro-1,3-diazinan-2-one?
The IUPAC name of 4-amino-5-fluoro-1,3-diazinan-2-one (CID 56629715) is 4-amino-5-fluoro-1,3-diazinan-2-one.
What is the SMILES notation for 4-amino-5-fluoro-1,3-diazinan-2-one?
The canonical SMILES for 4-amino-5-fluoro-1,3-diazinan-2-one is NC1NC(=O)NCC1F.
What is the InChIKey of 4-amino-5-fluoro-1,3-diazinan-2-one?
The InChIKey is XRITUBRVWHTBIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FN3O/c5-2-1-7-4(9)8-3(2)6/h2-3H,1,6H2,(H2,7,8,9).
What are the key properties of 4-amino-5-fluoro-1,3-diazinan-2-one?
4-amino-5-fluoro-1,3-diazinan-2-one has a molecular weight of 133.13 g/mol, XLogP of -1.08, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-fluoro-1,3-diazinan-2-one is sourced from PubChem (CID 56629715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).