About 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine
2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine (PubChem CID 56629729) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine.
Molecular Properties
| Compound Name | 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine |
| PubChem CID | 56629729 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine |
| SMILES | [H]/N=C1\C(C)CC(N)/C(=N/CCCC)N1C |
| InChI | InChI=1S/C11H22N4/c1-4-5-6-14-11-9(12)7-8(2)10(13)15(11)3/h8-9,13H,4-7,12H2,1-3H3/b13-10+,14-11- |
| InChIKey | TXLPDJQMVMDAGM-MBGGJNPXSA-N |
| XLogP | 1.46 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine?
The IUPAC name of 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine (CID 56629729) is 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine.
What is the SMILES notation for 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine?
The canonical SMILES for 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine is [H]/N=C1\C(C)CC(N)/C(=N/CCCC)N1C.
What is the InChIKey of 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine?
The InChIKey is TXLPDJQMVMDAGM-MBGGJNPXSA-N. The full InChI is InChI=1S/C11H22N4/c1-4-5-6-14-11-9(12)7-8(2)10(13)15(11)3/h8-9,13H,4-7,12H2,1-3H3/b13-10+,14-11-.
What are the key properties of 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine?
2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine has a molecular weight of 210.32 g/mol, XLogP of 1.46, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylimino-6-imino-1,5-dimethylpiperidin-3-amine is sourced from PubChem (CID 56629729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).