C19H29F3O4 — CID 56630139
5-heptoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56630139) has the molecular formula C19H29F3O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-heptoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-heptoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56630139 |
| Molecular Formula | C19H29F3O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 5-heptoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCCCCOC1COC(C2=CCC(OCC(F)(F)F)C=C2)OC1 |
| InChI | InChI=1S/C19H29F3O4/c1-2-3-4-5-6-11-23-17-12-24-18(25-13-17)15-7-9-16(10-8-15)26-14-19(20,21)22/h7-9,16-18H,2-6,10-14H2,1H3 |
| InChIKey | LWFJBOYBPVQYPY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|