C33H58O4 — CID 56630234
2-[(5S)-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]-5-[(1R,3R)-3-propylcyclopentyl]heptoxy]oxane (PubChem CID 56630234) has the molecular formula C33H58O4 and a molecular weight of 518.82 g/mol. Its IUPAC name is 2-[(5S)-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]-5-[(1R,3R)-3-propylcyclopentyl]heptoxy]oxane.
| Compound Name | 2-[(5S)-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]-5-[(1R,3R)-3-propylcyclopentyl]heptoxy]oxane |
|---|---|
| PubChem CID | 56630234 |
| Molecular Formula | C33H58O4 |
| Molecular Weight | 518.82 g/mol |
| Exact Mass | 518.43 |
| IUPAC Name | 2-[(5S)-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]-5-[(1R,3R)-3-propylcyclopentyl]heptoxy]oxane |
| SMILES | CC=C[C@H]1CCC[C@@H]1CC[C@H](CCCC(OC1CCCCO1)OC1CCCCO1)[C@@H]1CC[C@@H](CCC)C1 |
| InChI | InChI=1S/C33H58O4/c1-3-11-26-19-20-30(25-26)29(22-21-28-14-9-13-27(28)12-4-2)15-10-18-33(36-31-16-5-7-23-34-31)37-32-17-6-8-24-35-32/h4,12,26-33H,3,5-11,13-25H2,1-2H3/t26-,27+,28-,29+,30-,31?,32?,33?/m1/s1 |
| InChIKey | RSWANKAGIXGYNJ-BFCUXNKJSA-N |
| XLogP | 9.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.82 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|