About 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol
4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol (PubChem CID 56630437) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol.
Molecular Properties
| Compound Name | 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol |
| PubChem CID | 56630437 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol |
| SMILES | CC1(Cc2ccc(O)cc2)OCCO1 |
| InChI | InChI=1S/C11H14O3/c1-11(13-6-7-14-11)8-9-2-4-10(12)5-3-9/h2-5,12H,6-8H2,1H3 |
| InChIKey | JAJIUWBRJAQOHS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol?
The IUPAC name of 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol (CID 56630437) is 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol.
What is the SMILES notation for 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol?
The canonical SMILES for 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol is CC1(Cc2ccc(O)cc2)OCCO1.
What is the InChIKey of 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol?
The InChIKey is JAJIUWBRJAQOHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-11(13-6-7-14-11)8-9-2-4-10(12)5-3-9/h2-5,12H,6-8H2,1H3.
What are the key properties of 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol?
4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol has a molecular weight of 194.23 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol is sourced from PubChem (CID 56630437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).