About 3-nitrosopenta-1,4-diene
3-nitrosopenta-1,4-diene (PubChem CID 56630992) has the molecular formula C5H7NO
and a molecular weight of 97.12 g/mol. Its IUPAC name is 3-nitrosopenta-1,4-diene.
Molecular Properties
| Compound Name | 3-nitrosopenta-1,4-diene |
| PubChem CID | 56630992 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | 3-nitrosopenta-1,4-diene |
| SMILES | C=CC(C=C)N=O |
| InChI | InChI=1S/C5H7NO/c1-3-5(4-2)6-7/h3-5H,1-2H2 |
| InChIKey | FUXCHALORYTEDS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrosopenta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrosopenta-1,4-diene?
The IUPAC name of 3-nitrosopenta-1,4-diene (CID 56630992) is 3-nitrosopenta-1,4-diene.
What is the SMILES notation for 3-nitrosopenta-1,4-diene?
The canonical SMILES for 3-nitrosopenta-1,4-diene is C=CC(C=C)N=O.
What is the InChIKey of 3-nitrosopenta-1,4-diene?
The InChIKey is FUXCHALORYTEDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO/c1-3-5(4-2)6-7/h3-5H,1-2H2.
What are the key properties of 3-nitrosopenta-1,4-diene?
3-nitrosopenta-1,4-diene has a molecular weight of 97.12 g/mol, XLogP of 1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrosopenta-1,4-diene is sourced from PubChem (CID 56630992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).