C18H40O4Si2 — CID 56631115
(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-ol (PubChem CID 56631115) has the molecular formula C18H40O4Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-ol.
| Compound Name | (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-ol |
|---|---|
| PubChem CID | 56631115 |
| Molecular Formula | C18H40O4Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C18H40O4Si2/c1-17(2,3)23(7,8)21-13-15-16(19)14(11-12-20-15)22-24(9,10)18(4,5)6/h14-16,19H,11-13H2,1-10H3/t14-,15-,16-/m1/s1 |
| InChIKey | BHGUFTGUTAODQX-BZUAXINKSA-N |
| XLogP | 4.55 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|