C20H27F7O3 — CID 56631265
2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-hexyl-1,3-dioxane (PubChem CID 56631265) has the molecular formula C20H27F7O3 and a molecular weight of 448.42 g/mol. Its IUPAC name is 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-hexyl-1,3-dioxane.
| Compound Name | 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-hexyl-1,3-dioxane |
|---|---|
| PubChem CID | 56631265 |
| Molecular Formula | C20H27F7O3 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-hexyl-1,3-dioxane |
| SMILES | CCCCCCC1COC(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)OC1 |
| InChI | InChI=1S/C20H27F7O3/c1-2-3-4-5-6-14-11-28-17(29-12-14)15-7-9-16(10-8-15)30-20(26,27)19(24,25)18(22,23)13-21/h7-9,14,16-17H,2-6,10-13H2,1H3 |
| InChIKey | QNHHBXPUSLJCPT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|