C9H12O3 — CID 56631277
4,5-dihydroxy-3-methyl-2-prop-2-enylcyclopent-2-en-1-one (PubChem CID 56631277) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 4,5-dihydroxy-3-methyl-2-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | 4,5-dihydroxy-3-methyl-2-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 56631277 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 4,5-dihydroxy-3-methyl-2-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CCC1=C(C)C(O)C(O)C1=O |
| InChI | InChI=1S/C9H12O3/c1-3-4-6-5(2)7(10)9(12)8(6)11/h3,7,9-10,12H,1,4H2,2H3 |
| InChIKey | MAJJEFUYWFUYEU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|