C47H59F3O7 — CID 56632109
[(2R)-1,1,1-trifluorooctan-2-yl] 1-[6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl]oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate (PubChem CID 56632109) has the molecular formula C47H59F3O7 and a molecular weight of 792.98 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorooctan-2-yl] 1-[6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl]oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [(2R)-1,1,1-trifluorooctan-2-yl] 1-[6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl]oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 56632109 |
| Molecular Formula | C47H59F3O7 |
| Molecular Weight | 792.98 g/mol |
| Exact Mass | 792.42 |
| IUPAC Name | [(2R)-1,1,1-trifluorooctan-2-yl] 1-[6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carbonyl]oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)OC2CCc3cc(C(=O)Oc4c(C(=O)O[C@H](CCCCCC)C(F)(F)F)ccc5c4CCCC5)ccc3C2)cc1 |
| InChI | InChI=1S/C47H59F3O7/c1-3-5-7-9-10-11-12-16-30-54-38-26-22-34(23-27-38)44(51)55-39-28-24-35-31-37(21-20-36(35)32-39)45(52)57-43-40-18-15-14-17-33(40)25-29-41(43)46(53)56-42(47(48,49)50)19-13-8-6-4-2/h20-23,25-27,29,31,39,42H,3-19,24,28,30,32H2,1-2H3/t39?,42-/m1/s1 |
| InChIKey | LYLSDWPBLKSWOL-SVPXECHFSA-N |
| XLogP | 12.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.98 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|