C13H16O2 — CID 56632208
1,2,4a,6,6a,10,10a,10b-octahydrobenzo[c]chromen-9-one (PubChem CID 56632208) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1,2,4a,6,6a,10,10a,10b-octahydrobenzo[c]chromen-9-one.
| Compound Name | 1,2,4a,6,6a,10,10a,10b-octahydrobenzo[c]chromen-9-one |
|---|---|
| PubChem CID | 56632208 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1,2,4a,6,6a,10,10a,10b-octahydrobenzo[c]chromen-9-one |
| SMILES | O=C1C=CC2COC3C=CCCC3C2C1 |
| InChI | InChI=1S/C13H16O2/c14-10-6-5-9-8-15-13-4-2-1-3-11(13)12(9)7-10/h2,4-6,9,11-13H,1,3,7-8H2 |
| InChIKey | KZHGGLAPWPBAJO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|