C25H29FO2S — CID 56632255
(8S,10S,11S,13S,14S,17R)-9-fluoro-11-hydroxy-10,13-dimethyl-17-phenylsulfanyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 56632255) has the molecular formula C25H29FO2S and a molecular weight of 412.57 g/mol. Its IUPAC name is (8S,10S,11S,13S,14S,17R)-9-fluoro-11-hydroxy-10,13-dimethyl-17-phenylsulfanyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,11S,13S,14S,17R)-9-fluoro-11-hydroxy-10,13-dimethyl-17-phenylsulfanyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56632255 |
| Molecular Formula | C25H29FO2S |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (8S,10S,11S,13S,14S,17R)-9-fluoro-11-hydroxy-10,13-dimethyl-17-phenylsulfanyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](O)C3(F)[C@@H](CCC4=CC(=O)C=C[C@@]43C)[C@@H]1CC[C@H]2Sc1ccccc1 |
| InChI | InChI=1S/C25H29FO2S/c1-23-15-21(28)25(26)20(9-8-16-14-17(27)12-13-24(16,25)2)19(23)10-11-22(23)29-18-6-4-3-5-7-18/h3-7,12-14,19-22,28H,8-11,15H2,1-2H3/t19-,20-,21-,22+,23-,24-,25?/m0/s1 |
| InChIKey | XBXJAVOHVAICER-PSFXSKFSSA-N |
| XLogP | 5.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |