C18H21F7O — CID 56632368
2-(4-ethylcyclohexen-1-yl)-5-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,3-diene (PubChem CID 56632368) has the molecular formula C18H21F7O and a molecular weight of 386.35 g/mol. Its IUPAC name is 2-(4-ethylcyclohexen-1-yl)-5-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,3-diene.
| Compound Name | 2-(4-ethylcyclohexen-1-yl)-5-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56632368 |
| Molecular Formula | C18H21F7O |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-(4-ethylcyclohexen-1-yl)-5-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,3-diene |
| SMILES | CCC1CC=C(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)CC1 |
| InChI | InChI=1S/C18H21F7O/c1-2-12-3-5-13(6-4-12)14-7-9-15(10-8-14)26-18(24,25)17(22,23)16(20,21)11-19/h5,7-9,12,15H,2-4,6,10-11H2,1H3 |
| InChIKey | IRKBKQZLHPXOGP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|