C8Br2F12O — CID 56632525
4-bromo-2-(4-bromo-1,1,3,3,4,4-hexafluorobut-1-en-2-yl)oxy-1,1,3,3,4,4-hexafluorobut-1-ene (PubChem CID 56632525) has the molecular formula C8Br2F12O and a molecular weight of 499.87 g/mol. Its IUPAC name is 4-bromo-2-(4-bromo-1,1,3,3,4,4-hexafluorobut-1-en-2-yl)oxy-1,1,3,3,4,4-hexafluorobut-1-ene.
| Compound Name | 4-bromo-2-(4-bromo-1,1,3,3,4,4-hexafluorobut-1-en-2-yl)oxy-1,1,3,3,4,4-hexafluorobut-1-ene |
|---|---|
| PubChem CID | 56632525 |
| Molecular Formula | C8Br2F12O |
| Molecular Weight | 499.87 g/mol |
| Exact Mass | 497.81 |
| IUPAC Name | 4-bromo-2-(4-bromo-1,1,3,3,4,4-hexafluorobut-1-en-2-yl)oxy-1,1,3,3,4,4-hexafluorobut-1-ene |
| SMILES | FC(F)=C(OC(=C(F)F)C(F)(F)C(F)(F)Br)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C8Br2F12O/c9-7(19,20)5(15,16)1(3(11)12)23-2(4(13)14)6(17,18)8(10,21)22 |
| InChIKey | ZCFOEBGWQMZLFE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.87 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|