C19H16N2O3S — CID 56632554
5-[[4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indol-5-yl]oxy]thiophene-2-carbaldehyde (PubChem CID 56632554) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 5-[[4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indol-5-yl]oxy]thiophene-2-carbaldehyde.
| Compound Name | 5-[[4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indol-5-yl]oxy]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 56632554 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 5-[[4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indol-5-yl]oxy]thiophene-2-carbaldehyde |
| SMILES | COCc1c(C)ncc2[nH]c3cccc(Oc4ccc(C=O)s4)c3c12 |
| InChI | InChI=1S/C19H16N2O3S/c1-11-13(10-23-2)18-15(8-20-11)21-14-4-3-5-16(19(14)18)24-17-7-6-12(9-22)25-17/h3-9,21H,10H2,1-2H3 |
| InChIKey | VFQXFNYUFYMDKU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|