C23H31F7O — CID 56632929
5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-heptylcyclohexen-1-yl)cyclohexa-1,3-diene (PubChem CID 56632929) has the molecular formula C23H31F7O and a molecular weight of 456.49 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-heptylcyclohexen-1-yl)cyclohexa-1,3-diene.
| Compound Name | 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-heptylcyclohexen-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56632929 |
| Molecular Formula | C23H31F7O |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 5-(1,1,2,2,3,3,4-heptafluorobutoxy)-2-(4-heptylcyclohexen-1-yl)cyclohexa-1,3-diene |
| SMILES | CCCCCCCC1CC=C(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)CC1 |
| InChI | InChI=1S/C23H31F7O/c1-2-3-4-5-6-7-17-8-10-18(11-9-17)19-12-14-20(15-13-19)31-23(29,30)22(27,28)21(25,26)16-24/h10,12-14,17,20H,2-9,11,15-16H2,1H3 |
| InChIKey | OCGFGBUQOMZGGK-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|