C33H48O4S — CID 56633228
2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane (PubChem CID 56633228) has the molecular formula C33H48O4S and a molecular weight of 540.81 g/mol. Its IUPAC name is 2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane.
| Compound Name | 2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane |
|---|---|
| PubChem CID | 56633228 |
| Molecular Formula | C33H48O4S |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | 2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC5CCCCO5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H48O4S/c1-23(22-38(34,35)26-9-5-4-6-10-26)28-14-15-29-27-13-12-24-21-25(37-31-11-7-8-20-36-31)16-18-32(24,2)30(27)17-19-33(28,29)3/h4-6,9-10,12,23,25,27-31H,7-8,11,13-22H2,1-3H3/t23-,25+,27+,28-,29+,30+,31?,32+,33-/m1/s1 |
| InChIKey | AARIEFREDCSKTJ-YGGDRNLASA-N |
| XLogP | 7.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|