C13H13N3O4S2 — CID 56633417
(6S,7R)-3-imino-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid (PubChem CID 56633417) has the molecular formula C13H13N3O4S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (6S,7R)-3-imino-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid.
| Compound Name | (6S,7R)-3-imino-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 56633417 |
| Molecular Formula | C13H13N3O4S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (6S,7R)-3-imino-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
| SMILES | [H]/N=C1\CS[C@H]2[C@H](NC(=O)Cc3cccs3)C(=O)N2C1C(=O)O |
| InChI | InChI=1S/C13H13N3O4S2/c14-7-5-22-12-9(11(18)16(12)10(7)13(19)20)15-8(17)4-6-2-1-3-21-6/h1-3,9-10,12,14H,4-5H2,(H,15,17)(H,19,20)/b14-7+/t9-,10?,12+/m1/s1 |
| InChIKey | LWRGPWPGYLGINA-WZKQWGLOSA-N |
| XLogP | 0.16 |
| TPSA | 110.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|